Answer:
Human activities have a tremendous impact on the carbon cycle. Burning fossil fuels, changing land use, and using limestone to make concrete all transfer significant quantities of carbon into the atmosphere
Answer:
1. Roche limit
2. hydrogen
3. atmosphere
4. Mercury
5. Venus
6. When an object passes the Roche limit, the strength of gravity on the object increases. If the density of the planet is higher, then the object can break up farther away from the planet. If the density is lower, then the Roche limit is located closer to the planet.
7. Farther out in the solar system, beyond the frost line, hydrogen was at a low enough temperature that it could condense. This allowed hydrogen to accumulate under gravity, eventually forming the Jovian planets.
Explanation:
Answer:
False
Explanation:
When the proteins change its conformation and attain a 3-Dimensional structure therefore they form a pore or cleft like structure. This cleft is formed by the different part of the amino acid sequence which helps from the weak bonds between the proteins to the substrate.
The substrate gets attached to the active site and the enzymes lower down the activation energy of the reaction and thus proceeds the reaction at a faster speed.
Since the active site is the site for the attachment of the substrate and not other enzymes therefore False is the correct answer.
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
Answer:
The options are
it was too old to be used in modern times
it was too complicated for scientists to understand
scientists found new evidence to prove it invalid
scientists discovered a shorter theory to replace it
The answer is scientists found new evidence to prove it invalid
Steady State Theory of origin of the universe has been rejected due to new findings about how the universe was formed through carefully observing it which faulted past theories. This validates the option which states that scientists found new evidence to prove it invalid.
