The decision in Dred Scott v. Sandford i believe.
Answer:
2. planters
Explanation:
With the introduction of slavery in the South, the dominant people in the class structure became the planters. The planters were the people that owned large lands. They were mostly producing cash crops, the majority of which were for export in Europe. Considering the fact that their crops were in high demand and very well paid for, the planters quickly became very wealthy, which propelled them up into the hierarchy and to become the ones that control the society.
C is the right answer. Hope this helps!
The part of a ship providing accommodations for passengers with the cheapest tickets.
CFCs(chlorofluorocarbons) and CO2