Answer:
the one in 2016 is smaller so it doesn't have as much room for animals
Explanation:
Answer: It is...
Explanation:
The principal components of the plasma membrane are lipids (phospholipids and cholesterol), proteins, and carbohydrate groups that are attached to some of the lipids and proteins. A phospholipid is a lipid made of glycerol, two fatty acid tails, and a phosphate-linked head group.
Three<span> major </span>types of RNA<span> are mRNA, or messenger </span>RNA<span>, that serve as temporary copies of the information found in DNA; rRNA, or ribosomal </span>RNA<span>, that serve as structural components of protein-making structures known as ribosomes; and finally, tRNA, or transfer </span>RNA<span>, that ferry amino acids to the ribosome to be assembled</span>
Explanation:
hope this could help you!!!!
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
