Answer:
Answer is B
Explanation:
A multi cellular organism has different cells that performs different functions which brings about specialization unlike a unicellular organism which has one cell performing different functions.
Water I think I hope this helps
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
93,000 i multiplied with my calculator hope it helped
This is know as Transducer. Transducer is the basic purpose of all sense organs to convert stimulus energy into action potentials and it allow a<span>nything that converts one energy form into another. Transducer is the term that anything that converts one form of energy into another form of energy.</span>