All categories

4 years ago

Is the equation below balanced? Explain your answer. Zn(OH)2 + NaOH → Na2ZnO2 + H2O

Chemistry

1 answer:

iren2701 [21]4 years ago

7 0

Answer:

No, it is not balanced.

The balanced equation is: Zn(OH)₂ + 2NaOH → Na₂ZnO₂ + 2H₂O.

Explanation:

To balance the equation, you should apply the law of conservation of mass for the equations.

The law of conservation of mass states that the no. of each atom is equal in both sides (reactants and products).

For the given equation: <em>Zn(OH)₂ + NaOH → Na₂ZnO₂ + H₂O.</em>

The no. of Na atoms in reactants side is 1 but in products side is 2.

The no. of H atoms in reactants side is 3 but in product side is 2.

<em>So, the equation is not balanced.</em>

The balanced equation is:

The no. of all atoms is the same in both of reactants and products side.

Zn (1), O (4), H (4), and Na (2).

You might be interested in

Meiosis is the cell divison that occurs in non reproductive cells<br><br> True<br> False

icang [17]

The answer is true . hope this helps!

6 0

3 years ago

Which of the following is NOT correct about elements?

Lynna [10]

Answer: B. Elements are represented by chemical formulas.

Elements are pure substances, which means that they cannot be broken down into simpler substances. The element is the most basic substance that exists, breaking it down further means breaking it down into protons, neutrons, and electrons, which is no longer a substance.

Elements have chemical properties that allow them to form different types of bonds with other elements.

However, elements *alone* are not represented by their chemical formulas. Only chemical bonds or ions are represented by a chemical formula.

3 0

4 years ago

Read 2 more answers

Question 6

kompoz [17]

Considering the combined law equation, the new temperature is -244.56 °C or 28.44 K.

<h3>Boyle's law</h3>

Boyle's law states that the pressure of a gas in a closed container is inversely proportional to the volume of the container, when the temperature is constant: if the pressure increases, the volume decreases while if the pressure decreases, the volume increases.

Mathematically, this law states that the multiplication of pressure by volume is constant:

P×V=k

<h3>Charles's law</h3>

Charles's law states that the volume is directly proportional to the temperature of the gas: if the temperature increases, the volume of the gas increases while if the temperature of the gas decreases, the volume decreases.

Mathematically, Charles' law states that the ratio of volume to temperature is constant:

$\frac{V}{T} =k$

<h3>Gay-Lussac's law </h3>

Gay-Lussac's law states that the pressure of a gas is directly proportional to its temperature: increasing the temperature will increase the pressure, while decreasing the temperature will decrease the pressure.

Mathematically, Gay-Lussac's law states that the ratio of pressure to temperature is constant:

$\frac{P}{T} =k$

<h3>Combined law equation</h3>

Combined law equation is the combination of three gas laws called Boyle's, Charlie's and Gay-Lusac's law:

$\frac{PxV}{T} =k$

Considering an initial state 1 and a final state 2, it is fulfilled:

$\frac{P1xV1}{T1} =\frac{P2xV2}{T2}$

<h3>New temperature</h3>

In this case, you know:

P1= 1 atm= 760 mmHg
V1= 15 L
T1= -30 °C= 243 K (being 0 °C= 273 K)
P2= 58 mmHg
V2= 23 L
T2= ?

Replacing in the combined law equation:

$\frac{760 mmHgx15 L}{243 K} =\frac{58 mmHgx23 L}{T2}$

Solving:

$T2x\frac{760 mmHgx15 L}{243 K} =58 mmHgx23 L$

$T2 =\frac{58 mmHgx23 L}{\frac{760 mmHgx15 L}{243 K}}$

Finally, the new temperature is -244.56 °C or 28.44 K.

Learn more about combined law equation:

brainly.com/question/4147359

#SPJ1

6 0

2 years ago

50 points for anyone who answeres properly. How does a structure of a triglyceride differ from the reaction of fructose?

Nimfa-mama [501]

Answer:

Fatty Acids

A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.

Saturated Fatty Acids

In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.

Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.

Unsaturated Fatty Acids

In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.

Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.

Lipids and Diet

Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.

5 0

3 years ago

What is called the powerhouse of a cell because it breaks down nutrients to help make the major energy source of the cell?.

Lisa [10]

MITOCHONDRIA.
The powerhouse of a cell is Mitochondria, don’t you even forget this.

6 0

3 years ago