A local reaction will occur at the site of the exposure, such as irritations or damage to the skin, eyes or lungs true or flase
1 answer:
You might be interested in
Answer:
No you can not tell that recursion is ever required to solve a problem.
Recursion is required when in the problem, the solution of the input depends on the solution of the subsets of the input.
Iteration is also another form of repetitive approach we follow to solve that kind of problems.
But the difference between recursion and iteration is :
- In recursion we call the function repeatedly to return the result to next level.
- In iteration certain bunch of instructions in a loop are executed until certain conditions met.
Explanation:
For example in the Fibonacci sequence problem, to find , we need to compute
and
before that.
- In case of recursion we just call the method Fibonacci(n) repeatedly only changing the parameter Fibonacci(n-1), that calculates the value and return it.
Fibonacci(n)
1. if(n==0 or n==1)
2. return 1.
3.else
4. return( Fibonacci(n-1)+Fibonacci(n-1) )
- But in case of iteration we run a loop for i=2 to n, within which we add the value of current
and
to find the value of
Fibonacci(n)
1. if(n<=2)
2. result = 1
3. else
4. result1 =1 and result2=1.
5. { result = result1 +result2.
6. result1= result2.
7. result2 = result.
8. }
9. output result.