The correct alignment for a solar eclipse is <span>sun - moon - Earth. It is letter A.
>Solar Eclipse--only occurs when </span><span>Moon passes between Earth and Sun
>Its shadow has</span> two parts namely:
<span>1. Penumbra--<span>The Moon's faint outer shadow.
</span>2. Umbra---<span>The Moon's dark inner shadow.</span></span>
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
Answer:
For the object of to be considered alive , it must have DNA and all the characteristics of living things.
Explanation:
If one is to determine whether the object is alive or not the object should possess all the properties of living things. firstly, it should have the genetic material the DNA without which the cell can't be alive or the nucleus in case of PROKARYOTES. it should have the ability to reproduce, move , to grow and to excrete without which it would not be considered alive.
The reason why the cells have more ADP than ATP molecules is that the cells have the tendency to use more ATP, rather than restore ADP molecules.
When the body produces energy, in order to be able for it to be released in the body and to be used by the body, the ATP molecules break up. During that break up of the ATP molecule it actually loses one phosphate group, thus becoming an ADP molecule. Since this process is going on constantly, the ATP molecules are constantly breaking up thus resulting in constant new ADP molecules, so they are easily becoming outnumbered.
The answer would be: Palpate her abdomen to determine the intensity of labor contractions as they're taking place.
<span>The electronic fetal monitor is a device that can determine the contraction level based on the pressure it reads. The device could report a wrong result if it used incorrectly(if the position is wrong or the belt is too loose). It is important to validate the device results to make sure it is not wrong.</span>
