Answer:
•Vigor(higher or faster yield)
•Resistances against soil borne diseases (lower use of pesticides,lower loss of plants and lower need for crop rotation)
Answer:
Anthropogenic (human-caused) GHG emissions are modifying the Earth's energy balance between incoming solar radiation and the heat released back into space, amplifying the greenhouse effect and resulting in climate change.
Explanation:
While the natural greenhouse effect makes life possible on Earth, human activity can cause increased amounts of greenhouses gases to be produced in our atmosphere, resulting in a greenhouse effect.
Answer:
I think the heat cools and the bloon is brought back down
Explanation:
hope this helps
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
The correct answer is <span>D. circulatory, respiratory, nervous, endocrine
The other systems mentioned in the first three examples don't maintain oxygen levels at that body strain level.</span>