All categories

3 years ago

2. If an object is buoyant, then it will (3 Points) fioat sink

Chemistry

1 answer:

velikii [3]3 years ago

6 0

Answer: If an object is buoyant, then it will float

Explanation:

Buoyancy is the term which describes a type of force which is also known as the upthrust force. This is an upward force upward force exerted by a fluid that opposes the weight of an immersed object.

The objects which are lighter than water easily float on the water due to the existence of this force and the objects which are heavier than water sink in the water due to the existence of this force.

Thus if an object is buoyant, then it will float.

You might be interested in

What is the ΔG for the following reaction at 25°C?

ikadub [295]

$\Delta G_{global}=\Delta G_{products}-\Delta G_{reagents}\\\\
\text{We should consider the stoichiometry:}\\\\
\Delta G=2\Delta G_{NO_2}-\Delta G_{N_2O_4}\\\\
\Delta G=2\cdot51.8-98.28=103.6-98.28\\\\
\boxed{\Delta G=5.32~kJ}$

4 0

3 years ago

Read 2 more answers

If the pressure of a gas sample is quadrupled and the absolute temperature is doubled, by what factor does the volume of the sam

Natasha_Volkova [10]

Answer:

D) 1/2

Explanation:

Using Ideal gas equation for same mole of gas as

$\frac {{P_1}\times {V_1}}{T_1}=\frac {{P_2}\times {V_2}}{T_2}$

Given,

P₂ = 4P₁

T₂ = 2T₁

Using above equation as:

$\frac {{P_1}\times {V_1}}{T_1}=\frac {{P_2}\times {V_2}}{T_2}$

$\frac {{P_1}\times {V_1}}{T_1}=\frac {{4\times P_1}\times {V_2}}{2\times T_1}$

$V_2=\frac{1}{2}\times V_1$

<u>The volume change by half of the original.</u>

7 0

4 years ago

Read 2 more answers

When is di- used in the name of a hydrocarbon?

harkovskaia [24]

Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane

6 0

3 years ago

which of the following testable questions will provide evidence that elements in the same group have similar properties?

Usimov [2.4K]

The testable question which will provide evidence that elements in the same group have similar properties is valency

<h3>What is the valency?</h3>

In essence, how many electrons are present in their outermost shell.

Valency and Groups in the periodic table, elements are arranged in order of their atomic numbers and hence, the periodic table is a systematic arrangement of elements in an array of vertical columns called Groups and horizontal arrays called Periods.

Complete question here:

which of the following testable questions will provide evidence that elements in the same group have similar properties A. Valency B. Orbit C. Group D. Period

Since, the reactive capacities of elements is dependent on the number of electrons on its outermost shell, we can conclude on this note that, Elements in the same group have similar properties.

Learn more on Groups and Valency:

brainly.com/question/1645905

4 0

2 years ago

24 grams of CH4 was added to the above reaction. Calculate the theoretical yield of CO2. A. 66 grams B. 33 grams c. 132 grams. D

Sonbull [250]

Answer:

Option A. 66 g

Explanation:

We'll begin by writing the balanced equation for the reaction. This is given below:

CH₄ + 2O₂ —> CO₂ + 2H₂O

Next, we shall determine the mass of CH₄ that reacted and the mass of CO₂ produced from the balanced equation. This is illustrated below:

Molar mass of CH₄ = 12 + (4×1)

= 12 + 4 = 16 g/mol

Mass of CH₄ from the balanced equation = 1 × 16 = 16 g

Molar mass of CO₂ = 12 + (16×2)

= 12 + 32 = 44 g/mol

Mass of CO₂ from the balanced equation = 1 × 44 = 44 g

SUMMARY:

From the balanced equation above,

16 g of CH₄ reacted to produce 44 g of CO₂.

Finally, we shall determine the theoretical yield of CO₂. this can be obtained as follow:

From the balanced equation above,

16 g of CH₄ reacted to produce 44 g of CO₂.

Therefore, 24 g of CH₄ will react to produce = (24 × 44) /16 = 66 g of CO₂.

Thus, the theoretical yield of CO₂ 66 g

8 0

3 years ago