The answer is A. Condensation is when a gas becomes a liquid. It happens when a gas, like water vapor, cools down. ... In condensation, matter changes from a gas to a liquid. All matter is made of tiny moving particles called molecules.
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
Explanation:
The answer is ( faramones). for mating purposes..
What are the choices....I would say the sea because I really don't understand what your trying to ask
Anaerobic respiration is different in plants and animals:
Anaerobic respiration occurs when oxygen is not available and occurs differently in animal and plant cells. In animal cells anaerobic respiration often occurs during exercise. ... It still occurs without oxygen but the glucose molecule is broken down into ethanol, carbon dioxide and a small amount of energy.
