None of the above is the answerr
its a gene that you either receive from your mother or father.
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
Answer:
Prokaryotes are organisms that consist of a single prokaryotic cell. Eukaryotic cells are found in plants, animals, fungi, and protists. They range from 10–100 μm in diameter, and their DNA is contained within a membrane-bound nucleus. Eukaryotes are organisms containing eukaryotic cells.
Explanation:
I would say the growth, the repair, and the reproduction.