Answer:
Genotypes: BG. Phenotypes: The tails would express both, blue and green, colors.
Explanation:
The codominance inheritance rule states that both alleles for a single trait will dominate and will be equally expressed. And, in this case, the alleles, B and G, for tail color will be equally expressed in their offspring.
Hope this helps!
Plato answer:
Stimulation of a neuron causes a change in the charge inside the cell from negative to positive. This change is caused by ions, which are atoms with an electrical charge, moving across the cell. This change within the cell is consistent with the definition of an electric charge.
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
Answer: Option D
Explanation:
The sensory information that is entering from the dorsal ramus of the body is most likely to come from exteroreceptors on the back.
Exteroreceptor are the different afferent nerve endings that has the ability to sense stimuli which originates from the outside of the body such vibration, sound, pain, touch et cetera.
These receptors carry signals from the external back to the dorsal ramus of the spinal cord.
C) United states
it have the most greenhouse gases
