Answer:
$48
Step-by-step explanation:
1. 192/12 = 16
2. 16 * 3 = 48
3. Your answer is 48
Answer:
Step-by-step explanation:
hen molecular hydrogen (H2) and oxygen (O2) are combined and allowed to react together, energy is released and the molecules of hydrogen and oxygen can combine to form either water or hydrogen peroxide. These two processes are represented by the two chemical equations shown at right.
Answer:
you're screwed
Step-by-step explanation:
don't forget your phone so anyon doesn't ever have to do this
Hello,
n=1,2,3,.... and not 0
Answer B a(n)=-2*n
Answer:
Option C
Step-by-step explanation:
Addition theory of probability is used to determine the probability for union of two or more sets.
P(AUB) = P(A)+P(B)-P(AB) is the addition theory of probability for two sets A and B.
P(AUBUC) = P(A)+P(B)+P(C)-P(AB)-P(BC)-P(CA)
for 3 sets
This can be extended to any number of sets
So addition theory has nothing to do with independent events both occurring
Option c is the right answer.
