Answer:
All description is given in explanation.
Explanation:
Van der Waals forces:
It is the general term used to describe the attraction or repulsion between the molecules. Vander waals force consist of two types of forces:
1. London dispersion forces
2. Dipole-dipole forces
1. London dispersion forces:
These are the weakest intermolecular forces. These are the temporary because when the electrons of atoms come close together they create temporary dipole, one end of an atom where the electronic density is high is create negative pole while the other becomes positive . These forces are also called induce dipole- induce dipole interaction.
2. Dipole-dipole forces:
These are attractive forces , present between the molecules that are permanently polar. They are present between the positive end of one polar molecules and the negative end of the other polar molecule.
Hydrogen bonding:
It is the electrostatic attraction present between the atoms which are chemically bonded. The one atom is hydrogen while the other electronegative atoms are oxygen, nitrogen or flourine. This is weaker than covalent and ionic bond.
Ionic bond or electrostatic attraction:
It is the electrostatic attraction present between the oppositely charged ions. This is formed when an atom loses its electron and create positive charge and other atom accept its electron and create negative charge.
Hydrophobic interaction:
It is the interaction between the water and hydrophobic material. The hydrophobic materials are long chain carbon containing compound. These or insoluble in water.
Covalent bond:
These compounds are formed by the sharing of electrons between the atoms of same elements are between the different element's atoms. The covalent bond is less stronger than ionic bond so require less energy to break as compared to the energy require to break the ionic bond.
The third answer because there are two of each atom
Answer:
0.7g of HCl
Explanation:
First, let us write a balanced equation for the reaction between HCl and Al(OH)3.
This is illustrated below:
Al(OH)3 + 3HCl —> AlCl3 + 3H2O
Next, let us obtain the masses of Al(OH)3 and HCl that reacted together according to the equation. This can be achieved as shown below:
Molar Mass of Al(OH)3 = 27 + 3(16+1)
= 27 + 3(17) = 27 + 51 = 78g/mol.
Molar Mass of HCl = 1 + 35.5 = 36.5g/mol
Mass of HCl from the balanced equation = 3 x 36.5 = 109.5g
Now we can obtain the mass of HCl that would react with 0.5g of Al(OH)3. This can be achieved as follow:
Al(OH)3 + 3HCl —> AlCl3 + 3H2O
From the equation above,
78g of Al(OH)3 reacted with 109.5g of HCl.
Therefore, 0.5g of Al(OH)3 will react with = (0.5 x 109.5)/78 = 0.7g of HCl
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Explanation:
there you go you can just look up atomic model for CD and click images
