The autonomic nervous system (ANS) is the part of the nervous system which is involuntary. It is composed of neurons that is responsible for impulsing the central nervous system to muscles and glands. The hypothalamus is the most important part and main control center of ANS. It is responsible for many homeostatic processes inside our body. Both the autonomic function and the endocrine function is regulated by the hypothalamus.
Hello!
To determine the chemical properties of minerals we need to understand the types of atoms!
Things like clevage, luster, and hardiness are all physical traits and don't relate to the chemical makeup. Chemical properties are things like their composition.
Hope this helps answer your question.
2.) 0.2 cm to 6.4 cm
3.) Pebbles
4.) 10 cm/s
If people send link don’t use them report!
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.