Answer/Step-by-step explanation:
Area of trapezium = ½*(AD + BC)*AB
Area = 42 cm²
AD = (x + 8) cm
BC = (x + 5) cm
AB = x cm
Plug in the values into the equation
42 = ½((x + 8) + (x + 5))*x
42 = ½((x + 8 + x + 5)*x
42 = ½(2x + 13)*x
Multiply both sides by 2
42*2 = (2x + 13)*x
84 = 2x² + 13x
2x² + 13x = 84
Subtract both sides by 84
2x² + 13x - 84 = 0
2.325647 is your answer .
Answer:
This is the only answer I could think of to give you
Step-by-step explanation:
The following statement
'In general, men who took drug x maintained or increased the number of visible scalp hairs; while scalp hairs counts in men who took the placebo continued to decrease'
can be referred as descriptive statistics, since we are saying that the msot of the men who took the drug gain scalp hairs while the contrary happened from those men who took placebo.
On the other hand, the statement
'drug x is effective in maintaining or increasing the amount of scalp hair in men'
Is a deduction you make, so it can be referred as inferential statistics
Answer:
Option C
Step-by-step explanation:
Addition theory of probability is used to determine the probability for union of two or more sets.
P(AUB) = P(A)+P(B)-P(AB) is the addition theory of probability for two sets A and B.
P(AUBUC) = P(A)+P(B)+P(C)-P(AB)-P(BC)-P(CA)
for 3 sets
This can be extended to any number of sets
So addition theory has nothing to do with independent events both occurring
Option c is the right answer.
