1answer.
Ask question
Login Signup
Ask question
All categories
  • English
  • Mathematics
  • Social Studies
  • Business
  • History
  • Health
  • Geography
  • Biology
  • Physics
  • Chemistry
  • Computers and Technology
  • Arts
  • World Languages
  • Spanish
  • French
  • German
  • Advanced Placement (AP)
  • SAT
  • Medicine
  • Law
  • Engineering
GenaCL600 [577]
3 years ago
13

Alex sold wrapping paper rolls (r) as part of a school fundraiser. He earned a total of 165 reward points from his sales. Using

the equation 2.5r = 165, how many rolls of wrapping paper did Alex sell?
Mathematics
1 answer:
Dafna11 [192]3 years ago
5 0
He sold 66 wrapping paper because all you want to do is divide
You might be interested in
The formula for converting a temperature in Fahrenheit what temperature in Celsius is C equals 5/9 times The formula for convert
jeka57 [31]

Answer:

50 degrees C

Step-by-step explanation:

5/9(F-32)

5/9=.55555556

(122-32)=90

90×.555555556=50

4 0
3 years ago
Read 2 more answers
Assume that y varies directly as x then solve. If x = 12 <br> when y = 15 find x when y = 21.
Viefleur [7K]

Answer:

18

Step-by-step explanation:

12 and 15 are both dividable by 3 and 3 apart so if you subtract 21 by 3 than you get 18

7 0
2 years ago
Read 2 more answers
Find the six trig function values of the angle 240*Show all work, do not use calculator
-BARSIC- [3]

Solution:

Given:

240^0

To get sin 240 degrees:

240 degrees falls in the third quadrant.

In the third quadrant, only tangent is positive. Hence, sin 240 will be negative.

sin240^0=sin(180+60)

Using the trigonometric identity;

sin(x+y)=sinx\text{ }cosy+cosx\text{ }siny

Hence,

\begin{gathered} sin(180+60)=sin180cos60+cos180sin60 \\ sin180=0 \\ cos60=\frac{1}{2} \\ cos180=-1 \\ sin60=\frac{\sqrt{3}}{2} \\  \\ Thus, \\ sin180cos60+cos180sin60=0(\frac{1}{2})+(-1)(\frac{\sqrt{3}}{2}) \\ sin180cos60+cos180sin60=0-\frac{\sqrt{3}}{2} \\ sin180cos60+cos180sin60=-\frac{\sqrt{3}}{2} \\  \\ Hence, \\ sin240^0=-\frac{\sqrt{3}}{2} \end{gathered}

To get cos 240 degrees:

240 degrees falls in the third quadrant.

In the third quadrant, only tangent is positive. Hence, cos 240 will be negative.

cos240^0=cos(180+60)

Using the trigonometric identity;

cos(x+y)=cosx\text{ }cosy-sinx\text{ }siny

Hence,

\begin{gathered} cos(180+60)=cos180cos60-sin180sin60 \\ sin180=0 \\ cos60=\frac{1}{2} \\ cos180=-1 \\ sin60=\frac{\sqrt{3}}{2} \\  \\ Thus, \\ cos180cos60-sin180sin60=-1(\frac{1}{2})-0(\frac{\sqrt{3}}{2}) \\ cos180cos60-sin180sin60=-\frac{1}{2}-0 \\ cos180cos60-sin180sin60=-\frac{1}{2} \\  \\ Hence, \\ cos240^0=-\frac{1}{2} \end{gathered}

To get tan 240 degrees:

240 degrees falls in the third quadrant.

In the third quadrant, only tangent is positive. Hence, tan 240 will be positive.

tan240^0=tan(180+60)

Using the trigonometric identity;

tan(180+x)=tan\text{ }x

Hence,

\begin{gathered} tan(180+60)=tan60 \\ tan60=\sqrt{3} \\  \\ Hence, \\ tan240^0=\sqrt{3} \end{gathered}

To get cosec 240 degrees:

\begin{gathered} cosec\text{ }x=\frac{1}{sinx} \\ csc240=\frac{1}{sin240} \\ sin240=-\frac{\sqrt{3}}{2} \\  \\ Hence, \\ csc240=\frac{1}{\frac{-\sqrt{3}}{2}} \\ csc240=-\frac{2}{\sqrt{3}} \\  \\ Rationalizing\text{ the denominator;} \\ csc240=-\frac{2}{\sqrt{3}}\times\frac{\sqrt{3}}{\sqrt{3}} \\  \\ Thus, \\ csc240^0=-\frac{2\sqrt{3}}{3} \end{gathered}

To get sec 240 degrees:

\begin{gathered} sec\text{ }x=\frac{1}{cosx} \\ sec240=\frac{1}{cos240} \\ cos240=-\frac{1}{2} \\  \\ Hence, \\ sec240=\frac{1}{\frac{-1}{2}} \\ sec240=-2 \\  \\ Thus, \\ sec240^0=-2 \end{gathered}

To get cot 240 degrees:

\begin{gathered} cot\text{ }x=\frac{1}{tan\text{ }x} \\ cot240=\frac{1}{tan240} \\ tan240=\sqrt{3} \\  \\ Hence, \\ cot240=\frac{1}{\sqrt{3}} \\  \\ Rationalizing\text{ the denominator;} \\ cot240=\frac{1}{\sqrt{3}}\times\frac{\sqrt{3}}{\sqrt{3}} \\  \\ Thus, \\ cot240^0=\frac{\sqrt{3}}{3} \end{gathered}

5 0
1 year ago
What is the rate and unit rate of 36 strikeouts in 54 innings?
Ksivusya [100]
0.78 strikeouts per minute
8 0
3 years ago
PLEASE HELP!! (will give brainliest for best answer)
Likurg_2 [28]

Answer:

i think the answer should be 60 ft long bc that would leave 10ft on each side of the banner

Step-by-step explanation:

hope this helps

5 0
3 years ago
Other questions:
  • In a given school, there are 240 boys and 260 girls.
    10·1 answer
  • What the answer thanks
    6·1 answer
  • Evaluate the expression (19+9)+(-9)
    13·2 answers
  • Which statement is true about whether A and B are
    7·1 answer
  • To win the game, Elena has to roll an even number first and a number less than 3 second. Her probability of winning is StartFrac
    9·1 answer
  • Help! I will mark you brianliest!
    10·1 answer
  • Claire wants to start a stamp collection. She spends $15 on an album to hold her stamps and $1.25 for each stamp. If she has $40
    7·1 answer
  • Solve for x.<br> 5/6x = 15<br> Enter your answer in the box.<br> X=
    8·1 answer
  • Which postulate proves the two
    9·2 answers
  • A drug prescription of 45 pills costs $427. 95. If each pill contains 3 mg of medication, what is the cost per milligrams?
    10·2 answers
Add answer
Login
Not registered? Fast signup
Signup
Login Signup
Ask question!