Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
Answer:
60 mph (miles per hour)
Explanation:
0.5 hours is 1/2 of an hour, so to get the number of miles for a whole hour you multiply the miles ran by 2.
30 times 2 is 60.
Answer:
The products are carbon dioxide and water
Explanation:
Step 1: Data given
Combustion = a reaction in which a substance reacts with oxygen gas, releasing energy in the form of light and heat. Combustion reactions must involve O2 as one reactant.
Step 2: The complete combustion of C3H7OH:
For the combustion of 1-propanol, we need O2.
The products of this combustion are CO2 and H2O.
C3H7OH + O2→ CO2 + H2O
On the left side we have 3x C (in c3H7OH), on the right side we have 1x C (in CO2). To balance the amount of C, we have to multiply CO2 on the right side by 3
C3H7OH + O2→ 3CO2 + H2O
On the left side we have 8x H (in C3H7OH) and 2x on the right side (in H2O). To balance the amount of H, we have to multiply H2O, on the right side by 4.
C3H7OH + O2→ 3CO2 + 4H2O
On the left side we have 3x O (1x in C3H7OH and 2x in O2), on the right side we have 10x O (6x in CO2 and 4x in H2O).
To balance the amount of O on both sides, we have to multiply C3H7OH by 2, multiply O2 by 9. Then we have to multiply 3CO2 by 2 and 4H2O by 2. Now the equation is balanced.
2C3H7OH + 9O2→ 6CO2 + 8H2O
For 2 moles propanol, we need 9 moles of O2 to produce 6 moles of CO2 and 8 moles Of H2O
The products are carbon dioxide and water
Answer:
Explanation:
3.
Knowns: 100mL of solution; concentration of 0.7M
Unknown: number of moles
Equation: number of moles = volume * concentration
Plug and Chug: number of moles = 100/1000 * 0.7 = 0.07 mole
Final Answer: 0.07mole
2.
Knowns: 5.50L of solution; concentration of 0.400M
Unknown: number of moles
Equation: number of moles = volume * concentration
Plug and Chug: number of moles = 5.5 * 0.4 = 2.20 mole
Final Answer: 2.20 mole
Answer:
True, in as far as greater magnitude = greater power.
