Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
<h2>Answer:</h2>
True
<h2>Explanation:</h2>
we can describe aptitude as an innate ability of a person to do something. There are different aptitude test in which we test the skills and ability to do different work or his attitude toward success or failure.
So, we can say that aptitude is the capacity to learn a particular skill or acquire a particular body of knowledge.
The <span>source of fuel that is most widely used today is Natural gas. The answer is letter C. The rest of the choices do not answer the question above,</span>
Given the fact that we are seeing a rise in the temperature of the globe, the artic animals in that ecosystem must adapt by a reduction in the rate of metabolism.
<h3>What is global warming?</h3>
Several evidences continue to emerge that the temperature of the earth have continued to increase and this is largely due to the fact that since the turn of the twentieth century and the rise of industrialization, there have been a rise in the emission of the carbon dioxide and other green house gases into the environment. As a result of this, the temperature of the earth has continued to rise steadily leading to the melting of the ice cover and the destruction of ecosystems that are found around the artic regions of the earth.
Now, we know that an organism is able to adapt to the changes that occur in its habitat by being able to alter some of its structure and function.
Given that the organisms that live in the artic are adapted to cold regions and low temperatures, the metabolic rate of the organisms is high in order to produce heat.
As a result of the rise in global temperatures, the organisms would have to reduce their rate of metabolism.
Learn more about global warming:brainly.com/question/12908180
#SPJ1
<span>Mol is the unit of amount of substance. It is equal to 6.02 x 10^23 molecules. Now, One mol of Sodium chloride (NaCl) contains 6.022x 10^23 molecules of NaCl. Also, the number atoms of both Na (sodium) and Cl (chlorine) will be equal. Similatly, One mol of Aluminium Chloride (AlCl3) contains 6.022x 10^23 molecules of (AlCl3) but the ratio of Al and Cl atoms will be 1:3</span>
