A source region must have certain temperature and humidity properties that can remain fixed for a substantial length of time to affect air masses above it. above it. Air mass source regions occur only in the high or low latitudes; middle latitudes are too variable.
Answer:
Explanation:
The covalent bond is the chemical bond between atoms where electrons are shared, forming a molecule. Covalent bonds are established between non-metallic elements, such as hydrogen H, oxygen O and chlorine Cl. These elements have many electrons in their outermost level (valence electrons) and have a tendency to gain electrons to acquire the stability of the electronic structure of noble gas.
The covalent bond between two atoms can be polar or nonpolar. If the atoms are equal, the bond will be nonpolar (since no atom attracts electrons more strongly). But, if the atoms are different, the bond will be polarized towards the most electronegative atom, because it will be the atom that attracts the electron pair with more force. Then it will be polar.
It can occur in a molecule that the bonds are polar and the molecule is nonpolar. This occurs because of the geometry of the molecule, which causes them to cancel the different equal polar bonds of the molecule.
In carbon tetrachloride the bonds are polar, but the tetrahedral geometry of the molecule causes all four dipoles to cancel out and the molecule to be apolar.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:4
Explanation:number 4 is the right answer :)
