Animals that feed primarily on arthropods and other soft-bodied invertebrates are called insectivores. These are carnivorous animals that feed on insects. such animals include lizards, frogs, and spiders. Another alternative are the entomophages, which are humans that practice eating of insects. There are also several species of carnivorous plants, that are insectivorous.
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
Answer:
It can provide if a number is greater than zero or less than zero
Explanation:
Answer: b. False
Explanation: It is the other way round when it comes to the definition of these terms.
Kinematics is the study of the motion of objects or points with its basic reference to factors such time, velocity, acceleration, distance, angle and so on. It is also known as the Geometry of Motion.
Kinetics is the study of the forces that are involved in the motion of an object. It deals basically with the cause and effect of that object.
Basically derived from Newton's Laws of Motion.
viruses i think again sorry if this is wrong