1answer.
Ask question
Login Signup
Ask question
All categories
  • English
  • Mathematics
  • Social Studies
  • Business
  • History
  • Health
  • Geography
  • Biology
  • Physics
  • Chemistry
  • Computers and Technology
  • Arts
  • World Languages
  • Spanish
  • French
  • German
  • Advanced Placement (AP)
  • SAT
  • Medicine
  • Law
  • Engineering
zhannawk [14.2K]
3 years ago
10

Can someone help me please

Mathematics
1 answer:
Kay [80]3 years ago
4 0

Answer:

the number that is not rational is -3.1311331113...

You might be interested in
1-What is the sum of the series? ​∑j=152j​ Enter your answer in the box.
tangare [24]

Answer:

Please see the Step-by-step explanation for the answers

Step-by-step explanation:

1)

∑\left \ {{5} \atop {j=1}} \right. 2j

The sum of series from j=1 to j=5 is:

∑ = 2(1) + 2(2) + 2(3) + 2(4) + 2(5)

  =  2 + 4 + 6 + 8 + 10

∑ = 30

2)

This question is not given clearly so i assume the following series that will give you an idea how to solve this:

∑\left \ {{4} \atop {k=1}} \right. 2k²

The sum of series from k=1 to j=4 is:

∑ = 2(1)² + 2(2)² + 2(3)² + 2(4)²

  = 2(1) + 2(4) + 2(9) + 2(16)

  =  2 + 8 + 18 + 32

∑ = 60

∑\left \ {{4} \atop {k=1}} \right. (2k)²

∑ = (2*1)² + (2*2)² + (2*3)² + (2*4)²

  = (2)² + (4)² + (6)² + (8)²

  = 4 + 16 + 36 + 64

∑ = 120

∑\left \ {{4} \atop {k=1}} \right. (2k)²- 4

∑ = (2*1)²-4 + (2*2)²-4 + (2*3)²-4 + (2*4)²-4

  = (2)²-4 + (4)²-4 + (6)²-4 + (8)²-4

  = (4-4) + (16-4) + (36-4) + (64-4)

  = 0 + 12 + 32 + 60

∑ = 104

∑\left \ {{4} \atop {k=1}} \right. 2k²- 4

∑ = 2(1)²-4 + 2(2)²-4 + 2(3)²-4 + 2(4)²-4

  = 2(1)-4 + 2(4)-4 + 2(9)-4 + 2(16)-4

  = (2-4) + (8-4) + (18-4) + (32-4)

  = -2 + 4 + 14 + 28

∑ = 44

3)

∑\left \ {{6} \atop {k=3}} \right. (2k-10)

∑ = (2×3−10) + (2×4−10) + (2×5−10) + (2×6−10)  

  = (6-10) + (8-10) + (10-10) + (12-10)

  = -4 + -2 + 0 + 2  

∑ = -4

4)

1+1/2+1/4+1/8+1/16+1/32+1/64

This is a geometric sequence where first term is 1 and the common ratio is 1/2 So

a = 1

This can be derived as

1/2/1 = 1/2 * 1 = 1/2

1/4/1/2 = 1/4 * 2/1 = 1/2

1/8/1/4 = 1/8 * 4/1  = 1/2

1/16/1/8 = 1/16 * 8/1  = 1/2

1/32/1/16 = 1/32 * 16/1  = 1/2

1/64/1/32 = 1/64 * 32/1  = 1/2

Hence the common ratio is r = 1/2

So n-th term is:

ar^{n-1} = 1(\frac{1}{2})^{n-1}

So the answer that represents the series in sigma notation is:

∑\left \ {{7} \atop {j=1}} \right. (\frac{1}{2})^{j-1}

5)

−3+(−1)+1+3+5

This is an arithmetic sequence where the first term is -3 and the common difference is 2. So  

a = 1

This can be derived as

-1 - (-3) = -1 + 3 = 2

1 - (-1) = 1 + 1 = 2

3 - 1 = 2

5 - 3 = 2

Hence the common difference d = 2

The nth term is:

a + (n - 1) d

= -3 + (n−1)2

= -3 + 2(n−1)

= -3 + 2n - 2

= 2n - 5

So the answer that represents the series in sigma notation is:

∑\left \ {{5} \atop {j=1}} \right. (2j−5)

6 0
3 years ago
A figure is translated horizontally 4 units. Which drawling shows a correct translation?
mash [69]

Answer: A

Step-by-step explanation: It is the only one being mirrored horizontally as, if the question said to find the one translated vertically, D would be the answer. C is incorrect because it just repeats the first figure and B is incorrect because it is translated vertically in an incorrect manner.

So in the end, The answer would be A.  

5 0
3 years ago
The amount of garbage, G produced by a city with population p is given by G = f(p). G is measured in tons per week, and p is mea
barxatty [35]
Alright, so this is simple.

P= 50,000 or 50 thousands

G= 13 Tons

The variable f isn't known.

So your equation would be 13 = 50 (f), if you were to put your known variables in the equation.

If you were to find variable f, you would divide 13 tons by 50,000 to get 0.00026 or in scientific notation: 2.6 x 10 (exponent(s):-4)



 

5 0
3 years ago
Help with number 22 plsssss
mario62 [17]

Answer:

192.972 mi/h

Step-by-step explanation:

To solve this, you have to add up all of the speeds and divide by how many values there are.

So if all of them are added together, it equals 771.888. Then, you divide this number by 4 to find the average. In this case, the average is 192.972mi/h.

3 0
3 years ago
Read 2 more answers
Question 16 (Essay Worth 7 points)<br><br> Verify the identity.<br><br> tan (x + π/2) = -cot x
Rus_ich [418]

Step-by-step explanation:

We know that tan=sin/cos, so tan(x+π/2)=

\frac{sin(x+pi/2)}{cos(x+pi/2)}

Then, we know that sin(u+v)=sin(u)cos(v)+cos(u)sin(v),

so our equation is then

\frac{sin(x)cos(\pi/2)+cos(x)sin(\pi/2)}{cos(x+\pi/2)}  = \frac{cos(x)}{cos(x+\pi/2) }

Then, cos(u+v)=cos(u)cos(v)-sin(u)sin(v), so our expression is then

\frac{cos(x)}{cos(x)cos(\pi/2)-sin(x)sin(\pi/2)} = \frac{cos(x)}{-sin(x)} = -cot(x)

6 0
3 years ago
Other questions:
  • Which of the following is a rational number?
    12·1 answer
  • Of 2x – 3y + 5 – (x – 3y) = 11 – 2x, what is the value of x?
    15·1 answer
  • 1. A line passes through the points (–4, –6) and (8, 4) a. Use point-slope form to write the equation of the line that is perpen
    8·1 answer
  • X-20 = y+20<br>2Y - 44 = X + 22<br>​
    13·1 answer
  • If events A and B are independent, find P(A│B).<br> A. P(A)<br> B. 1<br> C. 0<br> D. P(A)/P(B)
    11·1 answer
  • 8x + 2x - 5 = -35 <br><br> Can someone help me with this answer and how to show my work?
    8·1 answer
  • The percent change from $10 to $27
    5·1 answer
  • What is the factored form of 8x^24 - 27y^6
    14·1 answer
  • What are the domain and range of f(x) = |x + 6|?
    6·1 answer
  • A compound event in which the outcome of one event is affected by the outcome of another event is considered _________ events.
    13·1 answer
Add answer
Login
Not registered? Fast signup
Signup
Login Signup
Ask question!