Homogeneous because it completely dissolved so its now one. Heterogeneous would be when they don't dissolve and you see 2 separate substances like sand in water.
Answer:
Aye Wassup? Adam Here :D
Explanation:
Nitrogen dioxide is a chemical compound with the formula NO 2.It is one of several nitrogen oxides. NO 2 is an intermediate in the industrial synthesis of nitric acid, millions of tons of which are produced each year for use primarily in the production of fertilizers.At higher temperatures it is a reddish-brown gas.
Hope This Helped Bro: "AdamDaAssasin"
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
Water has polar O-H bonds. The negative O atoms attract the positive H atoms in nearby molecules, leading to the unusually strong type of dipole-dipole force called a hydrogen bond. Since water has hydrogen bonds, it also has dipole-induced dipole and London dispersion forces.
Hope it helped!!
Answer:
So I'm sure this is the answer to the eauations
