<span>
6 Find an exact value. sin 75°
</span>sin(A+B)=sin(A)cos(B)+cos(A)sin<span>(B)
</span>sin(45)=cos(45)=(2^0.5)/2 sin(30)=0.5 cos(30)=(3^0.5)/2
sin(45+30)=sin(45)cos(30)+cos(45)sin(30)=(6^0.5+2^0.5)/4
the answer is the letter d) quantity square root of six plus square root of two divided by four.
<span>
7. Find an exact value. sine of negative eleven pi divided by twelve.
</span>sin(-11pi/12) = -sin(11pi/12) = -sin(pi - pi/12) = -sin(pi/12) = -sin( (pi/6) / 2)
= - sqrt( (1-cos(pi/6) ) / 2) = -sqrt( (1-√3/2) / 2 ) = -(√3-1) / 2√2=(√2-√6)/4
the answer is the letter c) quantity square root of two minus square root of six divided by four.
<span>
8. Write the expression as the sine, cosine, or tangent of an angle. sin 9x cos x - cos 9x sin x
</span>
sin(A−B)=sinAcosB−cosAsinB
sin(9x−x)= sin9xcosx−cos9xsinx= sin(8x)
the answer is the letter c) sin 8x
<span>
9. Write the expression as the sine, cosine, or tangent of an angle. cos 112° cos 45° + sin 112° sin 45°</span>
cos(A−B)=cosAcosB<span>+sinA</span>sinB
cos(112−45)=cos112cos45<span>+sin112</span>sin45=cos(67)
the answer is the letter d) cos 67°
10. Rewrite with only sin x and cos x.
sin 2x - cos 2x
sin2x =
2sinxcosx<span>
cos2x = (cosx)^2 - (sinx)^2 = 2(cosx)^2 -1 = 1- 2(sinx)^2</span>
sin2x- cos2x=2sinxcosx-(1- 2(sinx)^2=2sinxcosx-1+2(sinx)^2
sin2x- cos2x=2sinxcosx-1+2(sinx)^2
<span>
the answer is the letter <span>
b) 2 sin x cos2x - 1
+ 2 sin2x</span></span>
I mean I think so I’m not completely sure it’s a really hard question
X< -2 means that x must be smaller than -2, so something like -3, -4, -5, etc
The only solution set that fits this is A.
Answer:
$24.35
Step-by-step explanation:
We will use the compound interest formula provided to solve this problem:

<em>P = initial balance</em>
<em>r = interest rate (decimal)</em>
<em>n = number of times compounded annually</em>
<em>t = time</em>
<em />
First, change 1% into a decimal:
1% ->
-> 0.01
Since the interest is compounded monthly, we will use 12 for n. Lets plug in the values now:


Lastly, subtract <em>A </em>from the principal to get the interest earned:

Area = Pi x r (r + v)
v is h^2 + r^2 under radical (couldn't write it in the equation above so I wrote it here)
The answer is the 1st choice, 1944 pi