Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
Answer:
(A). Result in different amino acids to be read due to frame shifts
Explanation:
Insertion or deletion mutations (or Indel mutations) can be defined as mutations in DNA due to insertion (addition) or deletion of nucleotide bases in DNA.
These mutations lead to change in reading frames (sequence of codons), which leads to formation of protein having completely different amino acid sequence. Hence, these mutations are also cause frameshift mutations.
This is due due to triplet nature of genetic codes as insertion or deletion of one or more bases (but not three) would change change in codon sequence and mutated sequence can form a non-functional or truncated protein.
Thus, the correct answer is option (A).
The deficiency of growth hormone during bone formation would cause a decreased proliferation of the epiphyseal plate cartilage. Growth hormone is a peptide hormone secreted by the pituitary gland under the control of the hypothalamus. It directly through IGF-I stimulates osteoblasts proliferation and activity, promoting bone formation. In addition it also stimulates osteoclast differentiation and activity, promoting bone resorption. Therefore, growth hormone is an important hormone in bone formation.
Answer:
Carbohydrates- these are food stuffs with sugar and fibers that provide energy to the body.
Fibres- these are things obtained from plants or animals.
Explanation:
When an ion or a molecule passes through a membrane without something facilitating, or encouraging that passage, such as a protein does. What drives it is the force of the diffusion itself instead.
