I believe it’s B. At least thats what makes sense for me.
Use the formula q=m×Cp×delta T
m=1.500 kg=1,500 g
Co=2.52 J/g·k
delta T=0.985k
q=(1,500g)(2.52 J/g·k)(0.985k)
=3,723.3 J=3.72
I JUST FINISHED THIS QUESTION AND IT SAID THAT THE ANSWER WAS -3.72 kJ SO PUT THAT DOWN AS YOUR ANSWER....I'm not sure why the answer is negative, but this is the most work I can show. If any one knows, why this answer is negative, please advise. Thank you. I hope that this helps :)
Bcz you’re able to wear something fresh, get a tan if you’d want, play volleyball or go out to swim in the cold ocean that feels so good when it’s hot !
Answer:
0.49 mol
Explanation:
Step 1: Write the balanced equation
Mg + 2 HCI ⇒ MgCl₂ + H₂
Step 2: Calculate the moles corresponding to 12 g of Mg
The molar mass of Mg is 24.31 g/mol.
Step 3: Calculate the moles of H₂ produced by 0.49 moles of Mg
The molar ratio of Mg to H₂ is 1:1. The moles of H₂ produced are 1/1 × 0.49 mol = 0.49 mol.
Answer:
ethylpentanoate
Explanation:
Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.
The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;
CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)
The name of the compound formed is ethylpentanoate.
