Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:B
Explanation:due to osmosis and osmoregulation of the cell membrane
Answer:
Chlorine atoms are smaller
Explanation:
Magnesium have more electrons than chlorine.
Answer:
bacteria is used by industries . Because some bacterias are very friendly
Answer:
The last option:
- NH₃ (aq) + H⁺ (aq) → NH₄⁺ (aq)
Explanation:
1) Word equation
- Aqueous ammonia + nitric acid → aqueous ammonium nitrate
2) Chemical (molecular) equation
- NH₃ (aq) + HNO₃ (aq) → NH₄ NO₃
3) Ionization reactions
Write the dissociation of the soluble ionic compounds:
4) Total ionic equation:
- NH₃ (aq) + H⁺ (aq) + NO₃⁻ (aq) → NH₄⁺ (aq) + NO₃⁻ (aq)
5) Net ionic equation
You must cancel the spectator ions, which are those ions that are repeated in both reactant and product sides, i.e. NO₃⁻. They are name spectator because they do not participate (change) during the reaction.
- NH₃ (aq) + H⁺ (aq) → NH₄⁺ (aq)
And that is the last choice of the list.