An example would be iodine has a lower relative atomic mass than tellurium, so it should come before tellurium in Mendeleev's table. In order to get iodine in the same group as the other elements with similar properties such as fluorine, chlorine, and bromine, he had to put it after tellurium, which broke his own rules.
Reactions like this one absorb energy because the reactants have less potential energy than the products.
<h3>What is an Endothermic reaction?</h3>
This is the type of reaction in which the reactants absorb heat energy from the surroundings to form products.
This brings about a decrease in the temperature as a result of the reactants having less potential energy than the products thereby making option B the most appropriate choice.
Read more about Endothermic reaction here brainly.com/question/6506846
It is c because I did it already
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
