All categories

4 years ago

Can someone help me I would really appreciate it

Chemistry

1 answer:

slega [8]4 years ago

8 0

The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.

You might be interested in

If you are pulling on a box with a force of 30 N, and your friend is pushing the box in the same direction with a force of 30 N,

dmitriy555 [2]

Answer:

The box will move towards me by the additional force of 60N.

Explanation:

I am pulling the box with a force of 30N and my friend is pushing the box in the same direction with a force of 30N.

Here two forces are exhibited in the same direction that is towards myself as a result the box will move towards me by an additional force of 30N+30N=60N.

7 0

3 years ago

Element x is a poor conductor of heat, has a low boiling point, and is a brittle solid at room temperature. where on the periodi

liraira [26]

With the nonmetals #Gradpoint

7 0

3 years ago

Read 2 more answers

What are the concentrations of A , A, B , B, and C C at equilibrium if, at the beginning of the reaction, their concentrations a

Elenna [48]

The question is incomplete, here is the complete question:

A reaction

$A+B\rightleftharpoons C$

has a standard free-energy change of -4.88 kJ/mol at 25°C

What are the concentrations of A, B, and C at equilibrium if at the beginning of the reaction their concentrations are 0.30 M, 0.40 M and 0 M respectively?

Answer: The equilibrium concentrations of A, B and C are 0.117 M, 0.217 M, 0.183 M respectively.

Explanation:

Relation between standard Gibbs free energy and equilibrium constant follows:

$\Delta G^o=-RT\ln K_c$

where,

$\Delta G^o$ = Standard Gibbs free energy = -4.88 kJ/mol = -4880 J/mol (Conversion factor: 1 kJ = 1000 J)

R = Gas constant = $8.314J/K mol$

T = temperature = $25^oC=[273+25]K=298K$

$K_c$ = equilibrium constant of the reaction

Putting values in above equation, we get:

$-4880J/mol=-(8.3145J/Kmol)\times 298K\times \ln K_c\\\\K_c=7.17$

We are given:

Initial concentration of A = 0.30 M

Initial concentration of B = 0.40 M

Initial concentration of C = 0 M

The chemical reaction follows:

$A+B\rightleftharpoons C$

Initial: 0.30 0.40 0

At eqllm: 0.30-x 0.40-x x

The expression of equilibrium constant for the above reaction follows:

$K_c=\frac{[C]}{[A][B]}$

We are given:

$K_c=7.17$

Putting values in above equation, we get:

$7.17=\frac{x}{(0.30-x)\times (0.40-x)}\\\\x=0.183,0.657$

Neglecting the value of x = 0.657, because change cannot be greater than the initial concentration

So, equilibrium concentration of A = $(0.30-x)=(0.30-0.183)=0.117M$

Equilibrium concentration of B = $(0.40-x)=(0.40-0.183)=0.217M$

Equilibrium concentration of C = $x=0.183M$

Hence, the equilibrium concentrations of A, B and C are 0.117 M, 0.217 M, 0.183 M respectively.

5 0

3 years ago

What type of bonding requires the complete transfer of an electron from one atom to another?

viktelen [127]

Answer:

An ionic bond

Explanation:

Metals and nonmetals form ionic bonds, in which the metal (low electronegativity) loses electrons to form a cation and the nonmetal (high electronegativity) gains electrons to form an anion. The cation and the anion attract each other through electrostatic forces.

3 0

3 years ago

What charge would an ion have if it had more electrons than protong?

max2010maxim [7]

Answer:

D. It would have a net negative charge

Explanation:

In an atom, there are electrons, protons and neutrons collectively called SUBATOMIC PARTICLES. The charge of an atom is determined by the number of electrons and protons in that atom. A neutral or uncharged atom possess the same number of electrons and protons.

The charge can thus be calculated as follows:

Charge of atom = no. of protons - no. of electrons.

Hence, when the number of electrons in an atom is higher than that of the protons, it means that the atom has gained negatively charged electrons, making that atom have a net negative charge. For example, In an atom that contains 10 protons and 11 electrons, the charge of that atom will be (10 - 11) = -1. The net charge of that atom will be -1, which is NEGATIVE.

4 0

3 years ago