3 years ago

Can someone help me I would really appreciate it

Chemistry

1 answer:

slega [8]3 years ago

8 0

The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.

You might be interested in

A compound distributes between benzene (solvent 1) and water (solvent 2) with a distribution coefficient, K = 2.7. If 1.0g of th

mote1985 [20]

Explanation:

The given data is as follows.

Solvent 1 = benzene, Solvent 2 = water

$K_{p}$ = 2.7, $V_{S_{2}}$ = 100 mL

$V_{S_{1}}$ = 10 mL, weight of compound = 1 g

Extract = 3

Therefore, calculate the fraction remaining as follows.

$f_{n} = [1 + K_{p}(\frac{V_{S_{2}}}{V_{S_{1}}})]^{-n}$

= $[1 + 2.7(\frac{100}{10})]^{-3}$

= $(28)^{-3}$

= $4.55 \times 10^{-5}$

Hence, weight of compound to be extracted = weight of compound - fraction remaining

= 1 - $4.55 \times 10^{-5}$

= 0.00001

or, = $1 \times 10^{-5}$

Thus, we can conclude that weight of compound that could be extracted is $1 \times 10^{-5}$ .

7 0

3 years ago

Read 2 more answers

Which of the following wouldn't be a good tool to use when measuring pH values of solutions?

aev [14]

litmus paper

Because it will just tell if the solution is acidic or basic, it won't tell the pH

4 0

3 years ago

Read 2 more answers

100 POINTS!!!

Paul [167]

what do u need help with u pls respond quickly

6 0

2 years ago

Read 2 more answers

1. A gas has a volume of 50.0 mL at a temperature of -73°C. What volume

Anton [14]

This is your answer:

-13 degrees C

3 0

3 years ago

……….CO + ………H2 --> C8H18 + ……… H2O

Ksenya-84 [330]

Answer:

8CO + 17H2 = C8H18 + 8H2O

8, 17, 1, 8

5 0

2 years ago