All categories

3 years ago

What is the ph of a very acidic solution?

Chemistry

1 answer:

Nadya [2.5K]3 years ago

8 0

Answer:

pH = -1

Explanation:

A solution of 10 mol·L⁻¹ HCl is very acidic.

HCl is a strong acid, so it dissociates completely in water and

$[\text{H}_{3}\text{O}^{+}] = \text{10 mol/L}$

To get the pH, you take the negative logarithm of the hydronium ion concentration.

$\text{pH} = -\log{(10)} = -1\\$

So, a pH = -1 represents a very acidic solution.

You might be interested in

Find the molar mass of H20. _______ grams per mole

Tpy6a [65]

It would be: 1 * 2 + 16 = 2 + 16 = 18

In short, Your Answer would be Option B

Hope this helps!

4 0

3 years ago

Classify each of these reactions pb(no3)2+nicl2=pbcl2+ni(no3)2

maxonik [38]

The reaction Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq) is a precipitation reaction.

A chemical reaction is said to occur when two or more substances are combined to produce new substances. Chemical reactions are classified based on the kind of change taking place in the reaction.

In the reaction;

Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq)

We can see that a solid is formed when lead II nitrate reacts with nickel II chloride. This is a precipitation reaction.

Learn more: brainly.com/question/5624100

4 0

3 years ago

For the reaction magnesium plus hyrdogen chloride yeilds hydrogen and magnesium chloride, calculate the percent yield of magnesi

Lina20 [59]

Answer:

Percentage yield of MgCl₂ = 83.4%

Explanation:

We'll begin by writing the balanced equation for the reaction. This is illustrated below:

Mg + 2HCl —> MgCl₂ + H₂

Next we shall determine the mass of of Mg that reacted and the mass of MgCl₂ produced from the balanced equation. This can be obtained as follow:

Molar mass of Mg = 24 g/mol

Mass of Mg from the balanced equation = 1 × 24 = 24 g

Molar mass of MgCl₂ = 24 + (35.5×2)

= 24 + 71

= 95 g/mol

Mass of MgCl₂ from the balanced equation = 1 × 95 = 95 g

SUMMARY:

From the balanced equation above,

24 g of Mg reacted to produce 95 g of MgCl₂.

Next, we shall determine the theoretical yield of MgCl₂. This can be obtained as follow:

From the balanced equation above,

24 g of Mg reacted to produce 95 g of MgCl₂.

Therefore, 100 g of Mg will react to produce = (100 × 95)/24 = 395.83 g of MgCl₂.

Thus, the theoretical yield of MgCl₂ is 395.83 g

Finally, we shall determine the percentage yield of MgCl₂. This can be obtained as follow:

Actual yield of MgCl₂ = 330 g

Theoretical yield of MgCl₂ = 395.83 g

Percentage yield of MgCl₂ =?

Percentage yield = Actual yield /Theoretical yield × 100

Percentage yield = 330 / 395.83 × 100

Percentage yield of MgCl₂ = 83.4%

3 0

3 years ago

How many molecules are in 0.25 moles of CH4

Brums [2.3K]

The base gram of the compound is 16.042

To find the new amount of grams, you need to multiply the amount of moles by the the base grams

16.042*.25=4.01

So one fourth of the compound is 4.01 grams of Carbon tetrahydride.

6 0

3 years ago

Using a mixture of water, sand, and chemicals under high pressure to free tightly held oil and natural gas is known as ____.

uysha [10]

<span>Using a mixture of water, sand, and chemicals under high pressure to free tightly held oil and natural gas is known as Hy</span>draulic fracturing.
<span>
This is a process commonly practiced in the United states where millions of gallons of water, sand, and chemicals are pumped underground. This is used to break apart the rock bed and release the gases that are deep in the ground.</span>

4 0

3 years ago