All categories

3 years ago

Classify each of these reactions pb(no3)2+nicl2=pbcl2+ni(no3)2

Chemistry

1 answer:

maxonik [38]3 years ago

4 0

The reaction Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq) is a precipitation reaction.

A chemical reaction is said to occur when two or more substances are combined to produce new substances. Chemical reactions are classified based on the kind of change taking place in the reaction.

In the reaction;

Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq)

We can see that a solid is formed when lead II nitrate reacts with nickel II chloride. This is a precipitation reaction.

Learn more: brainly.com/question/5624100

You might be interested in

Common additives to drinking water include elemental chlorine, chloride ions, and phosphate ions. Recently, reports of elevated

NeX [460]

Answer:

Check the explanation

Explanation:

Kindly check the attached image below to see the step by step explanation to the question above.

8 0

3 years ago

1 What direction do molecules move in?

notsponge [240]

Answer:

The majority of the molecules move from higher to lower concentration, although there will be some that move from low to high. The overall (or net) movement is thus from high to low concentration.

hope this helps!<3

3 0

3 years ago

For the reaction 2NOCl(g) <-----> 2NO(g) + Cl2(g), Kc = 8.0 at a certain temperature. What concentration of NOCl must be p

Nat2105 [25]

Answer is: concentration of NOCl is 3.52 M.

Balanced chemical reaction: 2NOCl(g) ⇄ 2NO(g) + Cl₂(g).
Kc = 8.0.
[NOCl] = 1.00 M; equilibrium concentration.
[NO] = x.
[Cl₂] = x/2; equilibrium concentration of chlorine.
Kc = [Cl₂] ·[NO]² / [NOCl].
8.00 = x/2 · x² / 1.
x³/2 = 8.
x = ∛16.
x = 2.52 M.
co(NOCl) = [NOCl] + x.
co(NOCl) = 1.00 M + 2.52 M.
co(NOCl) = 3.52 M; the initial concentration of NOCl.

7 0

3 years ago

Aspirin sun thesis Green Chemistry and Assime the aspirin is prepared by the following reaction and that 10.09. of salicylic aci

klemol [59]

Answer: The percentage yield of aspirin is 38.02 %.

Explanation:

To calculate the number of moles, we use the equation:

$\text{Number of moles}=\frac{\text{Given mass}}{\text{Molar mass}}$ .....(1)

For salicylic acid:

Given mass of salicylic acid $(C_7H_6O_3)$ = 10.09 g

Molar mass of salicylic acid $(C_7H_6O_3)$ = 138.12 g/mol

Putting values in equation 1, we get:

$\text{Moles of salicylic acid}=\frac{10.09g}{138.12g/mol}=0.0730mol$

The chemical equation for the formation of aspirin follows:

$C_7H_6O_3+C_4H_6O_3\rightarrow C_9H_8O_4+CH_3COOH$

As, acetic anhydride is present in excess. So, it is considered as an excess reagent.

Thus, salicylic acid is a limiting reagent because it limits the formation of products.

By Stoichiometry of the reaction:

1 mole of salicylic acid produces 1 mole of aspirin.

So, 0.0730 moles of salicylic acid will produce = $\frac{1}{1}\times 0.0730=0.0730mol$ of aspirin

Now, calculating the mass of aspirin from equation 1, we get:

Molar mass of aspirin = 180.16 g/mol

Moles of aspirin = 0.073 moles

Putting values in equation 1, we get:

$0.073mol=\frac{\text{Mass of aspirin}}{180.16g/mol}\\\\\text{Mass of aspirin}=13.15g$

To calculate the percentage yield of aspirin, we use the equation:

$\%\text{ yield}=\frac{\text{Experimental yield}}{\text{Theoretical yield}}\times 100$

Experimental yield of aspirin = 5.0 g

Theoretical yield of aspirin = 13.15 g

Putting values in above equation, we get:

$\%\text{ yield of aspirin}=\frac{5.0g}{13.15g}\times 100\\\\\% \text{yield of aspirin}=38.02\%$

Hence, the percent yield of aspirin is 38.01 %.

6 0

3 years ago

What is the original source of energy that is stored in the food that animals eat?

erastova [34]

Since plants turn sunlight into glucose (sugar) that humans and animals eat... the energy we get from our food comes indirectly from the sunlight.

5 0

3 years ago