Answer:
Chemical energy
Explanation:
When the body eats food our bodies convert the stored energy (calories) to chemical energy, allowing us to function.
Because of the sun reflects onto the moon and makes it brighter.
Answer:
7.
Explanation:
A neutral solution has a pH=7.
A basic solution has a pH>7.
An acidic solution has a pH<7.
Answer: Option (E) is the correct answer.
Explanation:
A spontaneous reaction is defined as the process which tends to occur on its own. And, a non-spontaneous reaction is defined as a process for the completion of which we have to provide certain conditions.
For example, ice melting at
is spontaneous primarily due to the increase in molecular disorder (dispersal of matter). Also, melting of ice is taking place on its own without any external force.
It is not necessary that all exothermic reactions will be exothermic in nature.
Thus, we can conclude that the statement all exothermic reactions are spontaneous, is false.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs