Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
Answer:
This question lacks options, however, it can be answered based on general understanding of the topic
The answer is SUBSTITUTION MUTATION
Explanation:
A mutation is any change that occurs in the nucleotide sequence of a gene. Mutation can be of different types depending on how it occurs. One type of mutation is SUBSTITUTION MUTATION, which is a mutation in which one or more nucleotide base is replaced by another in the sequence.
Nucleotide bases are read in a group of three called CODON. Each of these codons specify amino acid. Hence, if the nucleotide base sequence is altered during mutation, the amino acid sequence is altered likewise. In this case where the original amino acid sequence is: Met-Ala-Gln-Arg-Glu-Leu, the mutation affected the nucleotide bases coding for Arginine (Arg), hence changing it to Glycine (Gly).
This means that a base substitution mutation occured, replacing the amino acid Arginine with Glycine in the mutated sequence.
C. both biotic and abiotic factors in earth most ecosystems have both abiotic and biotic systems. They actually need both in order to survive.
