Answer: The missing coefficient is 2.
Explanation:
According to the law of conservation of mass, mass can neither be created nor be destroyed. Thus the mass of products has to be equal to the mass of reactants. The number of atoms of each element has to be same on reactant and product side. Thus chemical equations are balanced.

As in the products, there are 2 atoms of sodium, thus there will be 2 atoms of of sodium in the reactant as well. This will balance the number of hydrogen and oxygen atoms as well.
Thus the missing coefficient is 2.
<span>299,792,458 meters per <span>second</span></span>
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Almost all fusion taking place in the Sun is hydrogen fusing to helium, So A Helium-4 I think that the best choice.