I don't know but look on the internet or use a calculator
Well its Organic Chemistry... and is the Fractional Distillation of Crude Oil
In general, if a reaction is spontaneous, the reactants possess more free energy than the products.
<u>TRUE </u>
FALSE
Answer
RNA is single stranded
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
