RNA polymerase (green) synthesizes RNA by following a strand of DNA. RNA polymerase is an enzyme that is responsible for copying a DNA sequence into an RNA sequence, duyring the process of transcription.
Answer:
um what?
can u pls post ur question?
Explanation:
Answer: population of bacteria can survive and flourish by using light independence reactions
Explanation: So like the bacteria perform chemical reactions which produce energy for them
There are four haploid nuclei present in the last stage of meiosis II, which is telophase II. That is because the cytoplasm was being divided that results into four nuclei. Each of these has 23 chromosomes that contain a chromatid.
Answer:
True
Explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.
