The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
=7.89013× 10^47 moles of zinc
Explanation:
1 atom contains 6.023×10^23 moles.
1.31×10^24 atoms of zinc contain6.023×10^24×1.31×10^.24
Iron (iii) chloride is obtained by vapor condensation from the reaction between chlorine gas and iron fillings.
<h3>How can iron (iii) chloride be formed from iron fillings?</h3>
Iron (ii) chloride can be formed from iron fillings in the laboratory as follows:
- Iron fillings + Cl₂ → FeCl₃
Chlorine gas is introduced into a reaction vessel containing iron fillings and the iron (iii) chloride vapor formed is obtained by condensation.
In conclusion, iron (iii) chloride is formed by the the direct combination of iron fillings and chlorine gas.
Learn more about iron (iii) chloride at: brainly.com/question/14653649
#SPJ1
Answer: HCl
Explanation:
calcium carbonate dissolves in HCl acid producing CO 2 gas. It will not dissolve in pure water. The Ksp for calcium carbonate in water is 3.4 x 10-9 moldm-3 which is very low. What takes place here is actually a chemical reaction:
CaCO 3 (s) + 2HCl(aq) → CaCl 2 (aq) + H 2CO 3(aq)
This reaction accounts for the solubility of the Calcium carbonate in HCl and not in pure water.