Answer:
Planck made many contributions to theoretical physics, but his fame rests primarily on his role as originator of the quantum theory. This theory revolutionized our understanding of atomic and subatomic processes, just as Albert Einstein's theory of relativity revolutionized our understanding of space and time
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
A Campfire is an example, the solid wood becomes ash.
Answer:
Bonding Order = number of bonding electrons – number of antibonding electrons/2.
So for CO2, there is a total of 16 electrons, 8 of which are antibonding electrons.
So 16 – 8 = 8; divided by 2 = 4. So, 4 is the bonding order of CO2. The molecular structure of CO2 looks like this:
..~-~~..
O=C=O
..~-~~..
