Answer:
D, E
Step-by-step explanation:
(4x - 1) ^2 = 11 => (take square roots of both sides)
4x - 1 = +\- sqrt(11) => (Add 1 to both sides)
4x - 1 + 1 = 1 +\-sqrt(11) =>
4x + 0 = 1 +\- sqrt(11) => (Divide both sides by 4)
x = ( 1 +\- sqrt(11) ) /4
Which are choices D and E
The correct structure of the question is as follows:
The function f(x) = x^3 describes a cube's volume, f(x) in cubic inches, whose length, width, and height each measures x inches. If x is changing, find the (instantaneous) rate of change of the volume with respect to x at the moment when x = 3 inches.
Answer:
Step-by-step explanation:
Given that:
f(x) = x^3
Then;
V = x^3
The rate whereby V is changing with respect to time is can be determined by taking the differentiation of V
dV/dx = 3x^2
Now, at the moment when x = 3;
dV/dx = 3(3)^2
dV/dx = 3(9)
dV/dx = 27 cubic inch per inch
Suppose it is at the moment when x = 9
Then;
dV/dx = 3(9)^2
dV/dx = 3(81)
dV/dx = 243 cubic inch per inch
Answer for 1 is 22 degrees
Answer is choice C) cosine is even; sine is odd
The properties that come with even and odd functions are...
f(-x) = f(x) indicates we have an even function. So cos(-x) = cos(x)
f(-x) = -f(x) indicates we have an odd function. So sin(-x) = -sin(x)
note: the end result of the proof will lead to cos(A)cos(B)+sin(A)sin(B)
Answer: flirty, how he looks you in the eyes, does he like hanging with you? do you guys play around? Lastly, do you have a strong relationship status?
Step-by-step explanation:
