Consider this balanced chemical equation:
2 H2 + O2 → 2 H2O
We interpret this as “two molecules of hydrogen react with one molecule of oxygen to make two molecules of water.” The chemical equation is balanced as long as the coefficients are in the ratio 2:1:2. For instance, this chemical equation is also balanced:
100 H2 + 50 O2 → 100 H2O
This equation is not conventional—because convention says that we use the lowest ratio of coefficients—but it is balanced. So is this chemical equation:
5,000 H2 + 2,500 O2 → 5,000 H2O
Again, this is not conventional, but it is still balanced. Suppose we use a much larger number:
12.044 × 1023 H2 + 6.022 × 1023 O2 → 12.044 × 1023 H2O
These coefficients are also in the ratio of 2:1:2. But these numbers are related to the number of things in a mole: the first and last numbers are two times Avogadro’s number, while the second number is Avogadro’s number. That means that the first and last numbers represent 2 mol, while the middle number is just 1 mol. Well, why not just use the number of moles in balancing the chemical equation?
2 H2 + O2 → 2 H2O
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
There was 450.068g of water in the pot.
Explanation:
Latent heat of vaporisation = 2260 kJ/kg = 2260 J/g = L
Specific Heat of Steam = 2.010 kJ/kg C = 2.010 J/g = s
Let m = x g be the weight of water in the pot.
Energy required to vaporise water = mL = 2260x
Energy required to raise the temperature of water from 100 C to 135 C = msΔT = 70.35x
Total energy required = 
Hence, there was 450.068g of water in the pot.
Answer:
4.034x10^24 atoms
Explanation:
6.7 x 6.023x10^23 = 4.034x10^24 atoms
Answer:
the answer is D
Explanation:
percentage composition= mole of the substance divided by the total molar mass of the compound multiplied by 100.
