All categories

3 years ago

Factor (3c + 2)^2 - (3c - 2)^2

Mathematics

1 answer:

kodGreya [7K]3 years ago

6 0

Hi there! Your answe is 24c

Please see an explanation below for a clear understanding to your problem.

Any questions about my explanation and answer can be asked through comments! :)

Step-by-step explanation:

$\large \boxed{ {x}^{2} - {y}^{2} = (x + y)( x - y)}$

The formula above is what we will be using. This is called "Difference of Two Squares".

Notice how the these expressions are similar to the formula's structure.

$\large{ {(3c + 2)}^{2} - {(3c - 2)}^{2} }$

Notice how there are minus sign, squared expression which we can factor by using the formula above. Therefore -

$\large{ {x}^{2} = {(3c + 2)}^{2} } \\ \large{x = 3c + 2}$

Therefore, our y would be 3c-2.

Then proceed with the formula.

$\large{ {(3c + 2)}^{2} - {(3c - 2)}^{2} = (3c + 2 + 3c - 2)(3c + 2 - (3c - 2))}$

Simplify.

$\large{ (6c)(3c + 2 - 3c + 2)} \\ 6c(4) \\ 24c$

You might be interested in

Which can be used to describe an equivalent expression for (s^6)^-3

Nataly [62]

Answer:

there are three factors of 1/s^6

Step-by-step explanation:

5 0

3 years ago

Read 2 more answers

What is the length of Line segment A B? Round to the nearest tenth. Triangle A B C is shown. Angle A C B is a right angle and an

amm1812

C=90°, A=75°, b=AC=19, x=AB

Without a figure, we see AC is adjacent to angle A, so

cos A = AC/AB = b/x

x = b/cos A = 10 / cos 75° ≈ 38.637

Answer: 38.6

3 0

3 years ago

Read 2 more answers

( LETS SEE IF YOUR SMART )

ratelena [41]

Answer:

$6\leq x\leq 12$

Step-by-step explanation:

First we have to write down what it says in the question in as an expression. So we know that there is already 3 people on Britany's team (herself and the two friends), that in order to participate in the league you will need at least 9 players, and that the team can have a maximum of 15 player. So....

Let "x" be the number of people who decided to join Britany and her friends

Let "y" be the total number of people on Britanie's team, then .....

3 + x = y

Now we need to remember that in order to participate in the league you will need at least 9 players, and that the team can have a maximum of 15 player. We can write that down as......

$9\leq y\leq 15$

Now from this we know that the minimum value that x would need to take in order for Brittany's team to participate can be found by solving 3 + x = 9. The maximum value that x would need to take in order for Brittany's team to participate can be found by solving 3 + x = 15. And so we get.....

Minimum value:

3 + x = 9

x = 9 -3

x = 6

Maximum value:

3 + x = 15

x = 15 - 3

x = 12

Now we know that x will be equal to any integer between 6 and 12 so

$6\leq x\leq 12$

4 0

3 years ago

Please help if possible :)

mario62 [17]

Answer:

Step-by-step explanation:

12 x

--- = ---- --> 120 = 8x

8 10

120 = 8x

x = 15

8 0

3 years ago

Read 2 more answers

The equation of motion for a particle in meters at time t seconds is s(t)=sin(pi(t)/6)+cos(pi(t)/6), 0 is less then/equal to t i

Trava [24]

S(t) = sin(πt/6) + cos(πt/6)
Velocity = s'(t) = π/6 (cos(πt/6) - sin(πt/6))

When velocity = 0
cos(πt/6) - sin(πt/6) = 0
cos^2(πt/6) -2cos(πt/6) sin(πt/6) + sin^2(πt/6) = 0
1 - 2cos(πt/6) sin(πt/6) = 0
1 - sin(πt/3) = 0
sin(πt/3) = 1
πt/3 = arcsin(1) = π/2
t = 1.5

acceleration = s''(t) = -(π/6)^2 (cos(πt/6) + sin(πt/6))
s''(1.5) = -(π/6)^2 (cos(π/4) + sin(π/4)) = -(π/6)^2 (2/√2) = -0.3877
accerelation = -0.3877 meter/s^2

7 0

3 years ago