Potential energy<span> is the </span>energy<span> that is stored in an object due to its position relative to some zero position. It is calculated by the expression as follows:
PE = mgh
PE = 25 (9.8) (3)
PE = 735 J
Hope this answers the question. Have a nice day.</span>
I believe your answer is 23.
Credit: answers.yahoo.com
Hope this helps!
Our bone marrow continuously makes new red and white blood cells. The lymphatic system consists of the bone marrow, the spleen, the thymus (in young people), and lymph nodes.
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
According to the reaction equation:
CH3COO- + H+ → CH3COOH
initial 0.25 0.15
change - 0.025 + 0.025
Equ (0.25-0.025) (0.15 + 0.025)
first, we have to get moles acetate and moles acetic acid:
moles of acetate = 0.25 - 0.025 = 0.225 moles
∴ [CH3COO-] = 0.225 mol / 1 L = 0.225 M
moles of acetic acid = 0.15 + 0.025 = 0.175 moles
∴ [ CH3COOH] = 0.175 mol / 1L = 0.175 M
Pka = -㏒ Ka
= -㏒ 1.8 x 10^-5
= 4.74
from H-H equation we can get the PH value:
PH = Pka + ㏒ [acetate / acetic acid]
PH = 4.74 + ㏒[0.225/0.175]
∴ PH = 4.8
