Answer:
Ideal / Perfect <span>gas follows all of the gas laws.
Explanation:
Those gases which obeys Ideal gas equation are known as Ideal gases. The Ideal gas equation is a combination of all gas laws including Boyle's Law, Charle's Law and Avogadro's Law, it is mathematically expressed as
P V = n R T
Ideal gases are termed as those gases in which the intermolecular forces are negligible, therefore, these gases doesn't interact with each other.
On the other hand, real gases can be made ideal by increasing temperature and decreasing pressure.</span>
Answer:
2.50 g N2 and the second one is 21.5 g N2
Explanation:
just answered it and it was correct
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
What is true in a saturated solution is that it cannot dissolve any more solute.
A saturated solution is a chemical solution that contains the highest concentration (maximum capacity) of a solute dissolved in the solvent. When additional solute is added to a saturated solution, it will not dissolve it but it may result in a solid precipitate or left as a gas. The saturation of a solution depends on various factors such as temperatures, pressure, and the chemical makeup of substances involved. Examples of saturated solutions include; carbonated water and mixture of sugar and vinegar.