3 years ago

Helpppppp!!!!! It’s due today URGENT!!!!!

Chemistry

1 answer:

VladimirAG [237]3 years ago

5 0

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

You might be interested in

If you had 0.681 moles of caso4.2h2o, how many moles of h2o would you have?

IgorLugansk [536]

The answer is 0.008 moles

7 0

3 years ago

Where does the Sun’s light come from and why does it look different at different times of the day?

Contact [7]

Answer:

Sun light comes from the sun which is a part of our solar system

and it look different because the earth is spinning so the angle will can and that will determine if the sun rays will get light or darker

3 0

3 years ago

Which is true of electric cars?

lianna [129]

Answer:

they produce no DIRECT emissions

Explanation:

that is why they are good in cities to reduce air pollution . but sometypes can produce lesser emissions.

3 0

3 years ago

What impact does bleached coral have on the ecosystem in which it lives?

Aloiza [94]

Answer:

Bleached corals are likely to have reduced growth rates, decreased reproductive capacity, increased susceptibility to diseases and elevated mortality rates. Changes in coral community composition can occur when more susceptible species are killed by bleaching events.

8 0

3 years ago

You are given a solution of HCOOH (formic acid) with an approximate concentration of 0.20 M and you will titrate this with a 0.1

jeka57 [31]

Answer:

$\boxed{\text{36 mL}}$

Explanation:

1. Write the balanced chemical equation.

$\rm HCOOH + NaOH $ \longrightarrow$ HCOONa + H$_{2}$O$

2. Calculate the moles of HCOOH

$\text{Moles of HCOOH} =\text{20.00 mL HCOOH } \times \dfrac{\text{0.20 mmol HCOOHl}}{\text{1 mL HCOOH}} = \text{4.00 mmol HCOOH}$

3. Calculate the moles of NaOH.

$\text{Moles of NaOH = 4.00 mmol HCOOH } \times \dfrac{\text{1 mmol NaOH} }{\text{1 mmol HCOOH}} = \text{4.00 mmol NaOH}$

4. Calculate the volume of NaOH

$c = \text{4.00 mmol NaOH } \times \dfrac{\text{1 mL NaOH }}{\text{0.1105 mmol NaOH }} = \textbf{36 mL NaOH }\\\\\text{The titration will require }\boxed{\textbf{36 mL of NaOH}}$

3 0

3 years ago