Ask question

Ask question

All categories

3 years ago

11

Which two changes would make this reaction product-favored? 3H2 + N2 ⇄ 2NH3 + energy A. Decreasing the pressure B. Increasin

g the temperature C. Increasing the pressure D. Reducing the temperature

2 answers:

Dennis_Churaev [7]3 years ago

7 0

Answer:C and D

Explanation:Just did it

lapo4ka [179]3 years ago

7 0

Answer:

C+D

Explanation:

Ap3x

You might be interested in

Identify the solute with the highest van't Hoff factor. And how do you determine which one is highest?

german

Answer : The correct option is, (A) $AlCl_3$

Explanation :

Van't Hoff factor : It is defined as the ratio of the experimental value of the colligative property to the calculated value of the colligative property.

We can determine the van't Hoff factor by the association and dissociation of the compound.

(A) $AlCl_3$

It is an electrolyte that dissociates to give aluminum ion and chloride ion.

The dissociation of $AlCl_3$ will be,

$AlCl_3\rightarrow Al^{3+}+3Cl^{-}$

So, Van't Hoff factor = Number of solute particles = $Al^{3+}+3Cl^{-}$ = 1 + 3 = 4

(B) $KI$

It is an electrolyte that dissociates to give potassium ion and iodide ion.

The dissociation of $KI$ will be,

$KI\rightarrow K^{+}+I^{-}$

So, Van't Hoff factor = Number of solute particles = $K^{+}+I^{-}$ = 1 + 1 = 2

(C) $CaCl_2$

It is an electrolyte that dissociates to give calcium ion and chloride ion.

The dissociation of $CaCl_2$ will be,

$CaCl_2\rightarrow Ca^{2+}+2Cl^{-}$

So, Van't Hoff factor = Number of solute particles = $Ca^{2+}+2Cl^{-}$ = 1 + 2 = 3

(D) $MgSO_4$

It is an electrolyte that dissociates to give magnesium ion and sulfate ion.

The dissociation of $MgSO_4$ will be,

$MgSO_4\rightarrow Mg^{2+}+SO_4^{2-}$

So, Van't Hoff factor = Number of solute particles = $Mg^{2+}+SO_4^{2-}$ = 1 + 1 = 2

(E) Non-electrolyte

The dissociation non-electrolyte is not possible. So, the Van't Hoff factor will always be, 1.

Hence, the highest van't Hoff factor of solute is, $AlCl_3$

7 0

3 years ago

If 200 ml of 0.15 M propionic acid (PA) is added to 300 ml of 0.02 M NaOH, what is the resulting pH of the solution? Round the a

vodomira [7]

Answer:

pH = 4.543

Explanation:

CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
pKa = - Log Ka

∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

∴ pKa = 4.87

⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

added 300 mL 0f 0.02 M NaOH:

⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)

⇒ <em>C</em> CH3CH2COOH = 0.048 M

⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M

mass balance:

⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)

charge balance:

⇒ [H3O+] + [Na+] = [CH3CH2COO-]

∴ [Na+] = 0.02 M

⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)

(2) in (1):

⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]

replacing in Ka:

⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])

⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]

⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]

⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0

⇒ [H3O+ ] = 2.867 E-5 M

∴ pH = - Log [H3O+]

⇒ pH = 4.543

3 0

3 years ago

Which of the following is a pure substance

sergij07 [2.7K]

What is the following

8 0

3 years ago

What is the highest point of the wave a transverse wave called

topjm [15]

<span>The answer to the question "what is the highest point of the transverse wave called" is a crest or peak. A transverse wave is a wave in which the medium of the wave vibrates at 90 degrees to the direction in which the wave is moving at. The lowest points are called the troughs. Examples of transverse waves are light and electromagnetic radiation.</span>

7 0

3 years ago

Read 2 more answers

What is an experiment?

OLEGan [10]

Answer:

a scientific procedure undertaken to make a discovery, test a hypothesis, or demonstrate a known fact.

6 0

3 years ago