Answer:
sulfur-35
Explanation:
Sulfur-35 is a radioactive isotope that contains 19 neutrons.
Isotopes are represented with mass numbers. Mass number is the addition of number of proton and number of neutrons.
The number of proton in sulfur = 16
Number of neutron = 19
So, mass number = no. of protons + no. of neutrons
= 16 + 19
= 35
Hence, the correct answer is sulfur-35.
Answer:
Work done = 600 J
Power used = 60 W
Explanation:
Given:
Force acting on the box is, 
Displacement of the box is, 
Time taken for the work, 
Now, we know that, work is said to be done by a force only when there is displacement caused by the force in its direction.
Here, the force acting on the box causes a displacement of 30 m in its direction. So, work done is equal to the product of force and displacement caused.
Therefore, work done on the box is given as:
Therefore, the work done is 600 J.
Now, we know that, power is given as work done per unit time.
So, power used is given as:
Therefore, the power used is 60 W.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Parasitism... basically a tick and a dog. The dog is the host, which is harmed by the tick.
