One of the examples of Boyles law in action is a syringe
Answer:
protons : 10
electron : 10
neutron : 10
Explanation:
Protons will usually be the same as the electrons when its a <u>Atom</u> (when its a ion or covalent bond or simple bond they will most likely be different)
the atomic number represents protons and electrons
the mass number - the atomic number = neutron
Hydrogen ion<span>, strictly, the nucleus of a hydrogen atom separated from its accompanying electron. The hydrogen nucleus is made up of a particle carrying a unit positive electric charge, called a </span>proton<span>. The isolated hydrogen </span>ion<span>, represented by the symbol H </span>+<span>, is therefore customarily used to represent a </span>proton<span>.</span>
Answer:
6 moles of oxygen
Explanation:We can find from the chemistry equation
C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)
6 moles O2 ~4 moles H2O
Answer:
Increasing the temperature
Explanation:
According to Le Chatelier's principle, "if any of the conditions of a system in equilibrium is changed, the system will adjust itself in order to annul the effect of the change".
Since the forward reaction is exothermic, this suggests that heat is given off in the reaction.
Increasing the temperature will favors the reverse process which is endothermic.
In going from the reactants to the the products, the reaction is deemed exothermic which suggests that it produces heat.
The backward reaction is endothermic i.e it absorbs heat. If the temperature is increased, this process will be favored and more reactants produced. Less of the diiodine pentoxide will form. There is a leftward shift of the equilibrium
