The percentage yield of the new production technique is 82.8%
<h3>What is the percentage yield?</h3>
Production is the procedure by which finished products are obtained form the raw materials. The production process involves the passing of raw materials through a certain procedure that involves the use of certain machines and equipment to give us the required products.
We are told in the question that there are three shifts;
Shift 1 produces 4562 grams
Shift 2 produces 5783 grams
Shift 3 produces 5247 grams
Average production from the three shifts = 4562 grams + 5783 grams + 5247 grams/3 = 5197 grams
The theoretical average yield is = 7000 grams + 7000 grams + 7000 grams/3 = 7000 grams
Now the percentage yield = actual yield/ theoretical yield * 100/1
percentage yield = 5197 grams/7000 grams * 100/1
percentage yield = 82.8%
Learn more about percentage yield :brainly.com/question/27492865
#SPJ1
there are 8 moon phases.
They are - First quarter, waxing crescent, new, waning crescent, third quarter, Waning gibbous, full, and waxing gibbous
Nuclear reactions happen inside the nucleus,so it changes the protons and neutrons
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3