Answer:
The highly unstable pure sodium or potassium wants to lose an electron, and this splits the water atom, producing a negatively charged hydroxide ion and hydrogen and forming an explosive gas that ignites.
Explanation:
Answer: The religious fanaticism of Aurangzeb overshadowed his virtues. His reversal of Akbar's policy of religious toleration resulted in weakening the entire structure of the Mughal empire. It led to several conflicts and wars in different parts of the country.
The chemical formula for ammonia is NH3. So first, you need to find the molar mass of ammonia (how many grams in one mole).
N=14g
H3=3g
So one mole of NH3 is 17 grams, you can divide 82.9 grams by 17 grams to find the number of molecules. The answer should be 4.876 moles (molecules) of ammonia. Hope this helps!
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs