Answer:
In non-polar covalent bonds, the electrons are equally shared between the two atoms. For atoms with differing electronegativity, the bond will be a polar covalent interaction, where the electrons will not be shared equally.
Explanation:
i did some reasherch so there^^
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
The amount of W(OH)2 needed would be 448.126 g
<h3>Stoichiometric calculation</h3>
From the equation of the reaction:
W(OH)2 + 2 HCl → WCl2 + 2 H2O
The mole ratio of W(OH)2 to HCl is 1:2
Mole of 150g HCl = 150/36.461
= 4.11 moles
Equivalent mole of W(OH)2 = 4.11/2
= 2.06 moles
Mass of 2.06 moles W(OH)2 = 2.06 x 217.855
= 448.188g
More on stoichiometric calculations can be found here: brainly.com/question/8062886
A is the answer
Hope it helps :)
We will see that the volume of the unit cell is 144,070,699.06 pm^3
<h3>
How to get the volume of a body-centered cubic unit cell?</h3>
In a body-centered cubic unit cell, the side length of the cube is given as:
Where R is the radius of the atom.
And the volume of a cube is the side length cubed, then we can see that the volume of our cube will be:
Solving that we get:
This is the approximated volume of the unit cell.
If you want to learn more about unit cell structures, you can read:
brainly.com/question/13110055
